# Copyright 2024 The PyMC Developers
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
from collections.abc import Callable
import numpy as np
import numpy.random as nr
import pytensor
import scipy.linalg
import scipy.special
from pytensor import tensor as pt
from pytensor.graph.fg import MissingInputError
from pytensor.tensor.random.basic import BernoulliRV, CategoricalRV
import pymc as pm
from pymc.blocking import DictToArrayBijection, RaveledVars
from pymc.pytensorf import (
CallableTensor,
compile_pymc,
floatX,
join_nonshared_inputs,
replace_rng_nodes,
)
from pymc.step_methods.arraystep import (
ArrayStep,
ArrayStepShared,
PopulationArrayStepShared,
StatsType,
metrop_select,
)
from pymc.step_methods.compound import Competence
__all__ = [
"Metropolis",
"DEMetropolis",
"DEMetropolisZ",
"BinaryMetropolis",
"BinaryGibbsMetropolis",
"CategoricalGibbsMetropolis",
"NormalProposal",
"CauchyProposal",
"LaplaceProposal",
"PoissonProposal",
"MultivariateNormalProposal",
]
from pymc.util import get_value_vars_from_user_vars
# Available proposal distributions for Metropolis
class Proposal:
def __init__(self, s):
self.s = s
[docs]
class NormalProposal(Proposal):
def __call__(self, rng: np.random.Generator | None = None):
return (rng or nr).normal(scale=self.s)
[docs]
class CauchyProposal(Proposal):
def __call__(self, rng: np.random.Generator | None = None):
return (rng or nr).standard_cauchy(size=np.size(self.s)) * self.s
[docs]
class LaplaceProposal(Proposal):
def __call__(self, rng: np.random.Generator | None = None):
size = np.size(self.s)
r = rng or nr
return (r.standard_exponential(size=size) - r.standard_exponential(size=size)) * self.s
[docs]
class PoissonProposal(Proposal):
def __call__(self, rng: np.random.Generator | None = None):
return (rng or nr).poisson(lam=self.s, size=np.size(self.s)) - self.s
[docs]
class MultivariateNormalProposal(Proposal):
[docs]
def __init__(self, s):
n, m = s.shape
if n != m:
raise ValueError("Covariance matrix is not symmetric.")
self.n = n
self.chol = scipy.linalg.cholesky(s, lower=True)
def __call__(self, num_draws=None, rng: np.random.Generator | None = None):
rng_ = rng or nr
if num_draws is not None:
b = rng_.normal(size=(self.n, num_draws))
return np.dot(self.chol, b).T
else:
b = rng_.normal(size=self.n)
return np.dot(self.chol, b)
[docs]
class Metropolis(ArrayStepShared):
"""Metropolis-Hastings sampling step"""
name = "metropolis"
default_blocked = False
stats_dtypes_shapes = {
"accept": (np.float64, []),
"accepted": (np.float64, []),
"tune": (bool, []),
"scaling": (np.float64, []),
}
[docs]
def __init__(
self,
vars=None,
S=None,
proposal_dist=None,
scaling=1.0,
tune=True,
tune_interval=100,
model=None,
mode=None,
**kwargs,
):
"""Create an instance of a Metropolis stepper
Parameters
----------
vars: list
List of value variables for sampler
S: standard deviation or covariance matrix
Some measure of variance to parameterize proposal distribution
proposal_dist: function
Function that returns zero-mean deviates when parameterized with
S (and n). Defaults to normal.
scaling: scalar or array
Initial scale factor for proposal. Defaults to 1.
tune: bool
Flag for tuning. Defaults to True.
tune_interval: int
The frequency of tuning. Defaults to 100 iterations.
model: PyMC Model
Optional model for sampling step. Defaults to None (taken from context).
mode: string or `Mode` instance.
compilation mode passed to PyTensor functions
"""
model = pm.modelcontext(model)
initial_values = model.initial_point()
if vars is None:
vars = model.value_vars
else:
vars = get_value_vars_from_user_vars(vars, model)
initial_values_shape = [initial_values[v.name].shape for v in vars]
if S is None:
S = np.ones(int(sum(np.prod(ivs) for ivs in initial_values_shape)))
if proposal_dist is not None:
self.proposal_dist = proposal_dist(S)
elif S.ndim == 1:
self.proposal_dist = NormalProposal(S)
elif S.ndim == 2:
self.proposal_dist = MultivariateNormalProposal(S)
else:
raise ValueError("Invalid rank for variance: %s" % S.ndim)
self.scaling = np.atleast_1d(scaling).astype("d")
self.tune = tune
self.tune_interval = tune_interval
self.steps_until_tune = tune_interval
# Determine type of variables
self.discrete = np.concatenate(
[[v.dtype in pm.discrete_types] * (initial_values[v.name].size or 1) for v in vars]
)
self.any_discrete = self.discrete.any()
self.all_discrete = self.discrete.all()
# Metropolis will try to handle one batched dimension at a time This, however,
# is not safe for discrete multivariate distributions (looking at you Multinomial),
# due to high dependency among the support dimensions. For continuous multivariate
# distributions we assume they are being transformed in a way that makes each
# dimension semi-independent.
is_scalar = len(initial_values_shape) == 1 and initial_values_shape[0] == ()
self.elemwise_update = not (
is_scalar
or (
self.any_discrete
and max(getattr(model.values_to_rvs[var].owner.op, "ndim_supp", 1) for var in vars)
> 0
)
)
if self.elemwise_update:
dims = int(sum(np.prod(ivs) for ivs in initial_values_shape))
else:
dims = 1
self.enum_dims = np.arange(dims, dtype=int)
self.accept_rate_iter = np.zeros(dims, dtype=float)
self.accepted_iter = np.zeros(dims, dtype=bool)
self.accepted_sum = np.zeros(dims, dtype=int)
# remember initial settings before tuning so they can be reset
self._untuned_settings = dict(scaling=self.scaling, steps_until_tune=tune_interval)
# TODO: This is not being used when compiling the logp function!
self.mode = mode
shared = pm.make_shared_replacements(initial_values, vars, model)
self.delta_logp = delta_logp(initial_values, model.logp(), vars, shared)
super().__init__(vars, shared)
[docs]
def reset_tuning(self):
"""Resets the tuned sampler parameters to their initial values."""
for attr, initial_value in self._untuned_settings.items():
setattr(self, attr, initial_value)
self.accepted_sum[:] = 0
return
[docs]
def astep(self, q0: RaveledVars) -> tuple[RaveledVars, StatsType]:
point_map_info = q0.point_map_info
q0d = q0.data
if not self.steps_until_tune and self.tune:
# Tune scaling parameter
self.scaling = tune(self.scaling, self.accepted_sum / float(self.tune_interval))
# Reset counter
self.steps_until_tune = self.tune_interval
self.accepted_sum[:] = 0
delta = self.proposal_dist() * self.scaling
if self.any_discrete:
if self.all_discrete:
delta = np.round(delta, 0).astype("int64")
q0d = q0d.astype("int64")
q = (q0d + delta).astype("int64")
else:
delta[self.discrete] = np.round(delta[self.discrete], 0)
q = q0d + delta
else:
q = floatX(q0d + delta)
if self.elemwise_update:
q0d = q0d.copy()
q_temp = q0d.copy()
# Shuffle order of updates (probably we don't need to do this in every step)
np.random.shuffle(self.enum_dims)
for i in self.enum_dims:
q_temp[i] = q[i]
accept_rate_i = self.delta_logp(q_temp, q0d)
q_temp_, accepted_i = metrop_select(accept_rate_i, q_temp, q0d)
q_temp[i] = q0d[i] = q_temp_[i]
self.accept_rate_iter[i] = accept_rate_i
self.accepted_iter[i] = accepted_i
self.accepted_sum[i] += accepted_i
q = q_temp
else:
accept_rate = self.delta_logp(q, q0d)
q, accepted = metrop_select(accept_rate, q, q0d)
self.accept_rate_iter = accept_rate
self.accepted_iter = accepted
self.accepted_sum += accepted
self.steps_until_tune -= 1
stats = {
"tune": self.tune,
"scaling": np.mean(self.scaling),
"accept": np.mean(np.exp(self.accept_rate_iter)),
"accepted": np.mean(self.accepted_iter),
}
return RaveledVars(q, point_map_info), [stats]
[docs]
@staticmethod
def competence(var, has_grad):
return Competence.COMPATIBLE
def tune(scale, acc_rate):
"""
Tunes the scaling parameter for the proposal distribution
according to the acceptance rate over the last tune_interval:
Rate Variance adaptation
---- -------------------
<0.001 x 0.1
<0.05 x 0.5
<0.2 x 0.9
>0.5 x 1.1
>0.75 x 2
>0.95 x 10
"""
return scale * np.where(
acc_rate < 0.001,
# reduce by 90 percent
0.1,
np.where(
acc_rate < 0.05,
# reduce by 50 percent
0.5,
np.where(
acc_rate < 0.2,
# reduce by ten percent
0.9,
np.where(
acc_rate > 0.95,
# increase by factor of ten
10.0,
np.where(
acc_rate > 0.75,
# increase by double
2.0,
np.where(
acc_rate > 0.5,
# increase by ten percent
1.1,
# Do not change
1.0,
),
),
),
),
),
)
[docs]
class BinaryMetropolis(ArrayStep):
"""Metropolis-Hastings optimized for binary variables
Parameters
----------
vars: list
List of value variables for sampler
scaling: scalar or array
Initial scale factor for proposal. Defaults to 1.
tune: bool
Flag for tuning. Defaults to True.
tune_interval: int
The frequency of tuning. Defaults to 100 iterations.
model: PyMC Model
Optional model for sampling step. Defaults to None (taken from context).
"""
name = "binary_metropolis"
stats_dtypes_shapes = {
"accept": (np.float64, []),
"tune": (bool, []),
"p_jump": (np.float64, []),
}
[docs]
def __init__(self, vars, scaling=1.0, tune=True, tune_interval=100, model=None):
model = pm.modelcontext(model)
self.scaling = scaling
self.tune = tune
self.tune_interval = tune_interval
self.steps_until_tune = tune_interval
self.accepted = 0
vars = get_value_vars_from_user_vars(vars, model)
if not all([v.dtype in pm.discrete_types for v in vars]):
raise ValueError("All variables must be Bernoulli for BinaryMetropolis")
super().__init__(vars, [model.compile_logp()])
[docs]
def astep(self, apoint: RaveledVars, *args) -> tuple[RaveledVars, StatsType]:
logp = args[0]
logp_q0 = logp(apoint)
point_map_info = apoint.point_map_info
q0 = apoint.data
# Convert adaptive_scale_factor to a jump probability
p_jump = 1.0 - 0.5**self.scaling
rand_array = nr.random(q0.shape)
q = np.copy(q0)
# Locations where switches occur, according to p_jump
switch_locs = rand_array < p_jump
q[switch_locs] = True - q[switch_locs]
logp_q = logp(RaveledVars(q, point_map_info))
accept = logp_q - logp_q0
q_new, accepted = metrop_select(accept, q, q0)
self.accepted += accepted
stats = {
"tune": self.tune,
"accept": np.exp(accept),
"p_jump": p_jump,
}
return RaveledVars(q_new, point_map_info), [stats]
[docs]
@staticmethod
def competence(var):
"""
BinaryMetropolis is only suitable for binary (bool)
and Categorical variables with k=1.
"""
distribution = getattr(var.owner, "op", None)
if isinstance(distribution, BernoulliRV):
return Competence.COMPATIBLE
if isinstance(distribution, CategoricalRV):
# TODO: We could compute the initial value of `k`
# if we had a model object.
# k_graph = var.owner.inputs[3].shape[-1]
# (k_graph,), _ = rvs_to_value_vars((k_graph,), apply_transforms=True)
# k = model.fn(k_graph)(initial_point)
try:
k = var.owner.inputs[3].shape[-1].eval()
if k == 2:
return Competence.COMPATIBLE
except MissingInputError:
pass
return Competence.INCOMPATIBLE
[docs]
class BinaryGibbsMetropolis(ArrayStep):
"""A Metropolis-within-Gibbs step method optimized for binary variables
Parameters
----------
vars: list
List of value variables for sampler
order: list or 'random'
List of integers indicating the Gibbs update order
e.g., [0, 2, 1, ...]. Default is random
transit_p: float
The diagonal of the transition kernel. A value > .5 gives anticorrelated proposals,
which resulting in more efficient antithetical sampling. Default is 0.8
model: PyMC Model
Optional model for sampling step. Defaults to None (taken from context).
"""
name = "binary_gibbs_metropolis"
stats_dtypes_shapes = {
"tune": (bool, []),
}
[docs]
def __init__(self, vars, order="random", transit_p=0.8, model=None):
model = pm.modelcontext(model)
# Doesn't actually tune, but it's required to emit a sampler stat
# that indicates whether a draw was done in a tuning phase.
self.tune = True
# transition probabilities
self.transit_p = transit_p
vars = get_value_vars_from_user_vars(vars, model)
initial_point = model.initial_point()
self.dim = sum(initial_point[v.name].size for v in vars)
if order == "random":
self.shuffle_dims = True
self.order = list(range(self.dim))
else:
if sorted(order) != list(range(self.dim)):
raise ValueError("Argument 'order' has to be a permutation")
self.shuffle_dims = False
self.order = order
if not all([v.dtype in pm.discrete_types for v in vars]):
raise ValueError("All variables must be binary for BinaryGibbsMetropolis")
super().__init__(vars, [model.compile_logp()])
[docs]
def reset_tuning(self):
# There are no tuning parameters in this step method.
return
[docs]
def astep(self, apoint: RaveledVars, *args) -> tuple[RaveledVars, StatsType]:
logp: Callable[[RaveledVars], np.ndarray] = args[0]
order = self.order
if self.shuffle_dims:
nr.shuffle(order)
q = RaveledVars(np.copy(apoint.data), apoint.point_map_info)
logp_curr = logp(q)
for idx in order:
# No need to do metropolis update if the same value is proposed,
# as you will get the same value regardless of accepted or reject
if nr.rand() < self.transit_p:
curr_val, q.data[idx] = q.data[idx], True - q.data[idx]
logp_prop = logp(q)
q.data[idx], accepted = metrop_select(logp_prop - logp_curr, q.data[idx], curr_val)
if accepted:
logp_curr = logp_prop
stats = {
"tune": self.tune,
}
return q, [stats]
[docs]
@staticmethod
def competence(var):
"""
BinaryMetropolis is only suitable for Bernoulli
and Categorical variables with k=2.
"""
distribution = getattr(var.owner, "op", None)
if isinstance(distribution, BernoulliRV):
return Competence.IDEAL
if isinstance(distribution, CategoricalRV):
# TODO: We could compute the initial value of `k`
# if we had a model object.
# k_graph = var.owner.inputs[3].shape[-1]
# (k_graph,), _ = rvs_to_value_vars((k_graph,), apply_transforms=True)
# k = model.fn(k_graph)(initial_point)
try:
k = var.owner.inputs[3].shape[-1].eval()
if k == 2:
return Competence.IDEAL
except MissingInputError:
pass
return Competence.INCOMPATIBLE
[docs]
class CategoricalGibbsMetropolis(ArrayStep):
"""A Metropolis-within-Gibbs step method optimized for categorical variables.
This step method works for Bernoulli variables as well, but it is not
optimized for them, like BinaryGibbsMetropolis is. Step method supports
two types of proposals: A uniform proposal and a proportional proposal,
which was introduced by Liu in his 1996 technical report
"Metropolized Gibbs Sampler: An Improvement".
"""
name = "categorical_gibbs_metropolis"
stats_dtypes_shapes = {
"tune": (bool, []),
}
[docs]
def __init__(self, vars, proposal="uniform", order="random", model=None):
model = pm.modelcontext(model)
vars = get_value_vars_from_user_vars(vars, model)
initial_point = model.initial_point()
dimcats = []
# The above variable is a list of pairs (aggregate dimension, number
# of categories). For example, if vars = [x, y] with x being a 2-D
# variable with M categories and y being a 3-D variable with N
# categories, we will have dimcats = [(0, M), (1, M), (2, N), (3, N), (4, N)].
for v in vars:
v_init_val = initial_point[v.name]
rv_var = model.values_to_rvs[v]
distr = getattr(rv_var.owner, "op", None)
if isinstance(distr, CategoricalRV):
k_graph = rv_var.owner.inputs[3].shape[-1]
(k_graph,) = model.replace_rvs_by_values((k_graph,))
k = model.compile_fn(k_graph, inputs=model.value_vars, on_unused_input="ignore")(
initial_point
)
elif isinstance(distr, BernoulliRV):
k = 2
else:
raise ValueError(
"All variables must be categorical or binary" + "for CategoricalGibbsMetropolis"
)
start = len(dimcats)
dimcats += [(dim, k) for dim in range(start, start + v_init_val.size)]
if order == "random":
self.shuffle_dims = True
self.dimcats = dimcats
else:
if sorted(order) != list(range(len(dimcats))):
raise ValueError("Argument 'order' has to be a permutation")
self.shuffle_dims = False
self.dimcats = [dimcats[j] for j in order]
if proposal == "uniform":
self.astep = self.astep_unif
elif proposal == "proportional":
# Use the optimized "Metropolized Gibbs Sampler" described in Liu96.
self.astep = self.astep_prop
else:
raise ValueError("Argument 'proposal' should either be 'uniform' or 'proportional'")
# Doesn't actually tune, but it's required to emit a sampler stat
# that indicates whether a draw was done in a tuning phase.
self.tune = True
super().__init__(vars, [model.compile_logp()])
[docs]
def reset_tuning(self):
# There are no tuning parameters in this step method.
return
[docs]
def astep_unif(self, apoint: RaveledVars, *args) -> tuple[RaveledVars, StatsType]:
logp = args[0]
point_map_info = apoint.point_map_info
q0 = apoint.data
dimcats = self.dimcats
if self.shuffle_dims:
nr.shuffle(dimcats)
q = RaveledVars(np.copy(q0), point_map_info)
logp_curr = logp(q)
for dim, k in dimcats:
curr_val, q.data[dim] = q.data[dim], sample_except(k, q.data[dim])
logp_prop = logp(q)
q.data[dim], accepted = metrop_select(logp_prop - logp_curr, q.data[dim], curr_val)
if accepted:
logp_curr = logp_prop
stats = {
"tune": self.tune,
}
return q, [stats]
[docs]
def astep_prop(self, apoint: RaveledVars, *args) -> tuple[RaveledVars, StatsType]:
logp = args[0]
point_map_info = apoint.point_map_info
q0 = apoint.data
dimcats = self.dimcats
if self.shuffle_dims:
nr.shuffle(dimcats)
q = RaveledVars(np.copy(q0), point_map_info)
logp_curr = logp(q)
for dim, k in dimcats:
logp_curr = self.metropolis_proportional(q, logp, logp_curr, dim, k)
return q, []
[docs]
def astep(self, apoint: RaveledVars, *args) -> tuple[RaveledVars, StatsType]:
raise NotImplementedError()
[docs]
def metropolis_proportional(self, q, logp, logp_curr, dim, k):
given_cat = int(q.data[dim])
log_probs = np.zeros(k)
log_probs[given_cat] = logp_curr
candidates = list(range(k))
for candidate_cat in candidates:
if candidate_cat != given_cat:
q.data[dim] = candidate_cat
log_probs[candidate_cat] = logp(q)
probs = scipy.special.softmax(log_probs, axis=0)
prob_curr, probs[given_cat] = probs[given_cat], 0.0
probs /= 1.0 - prob_curr
proposed_cat = nr.choice(candidates, p=probs)
accept_ratio = (1.0 - prob_curr) / (1.0 - probs[proposed_cat])
if not np.isfinite(accept_ratio) or nr.uniform() >= accept_ratio:
q.data[dim] = given_cat
return logp_curr
q.data[dim] = proposed_cat
return log_probs[proposed_cat]
[docs]
@staticmethod
def competence(var):
"""
CategoricalGibbsMetropolis is only suitable for Bernoulli and
Categorical variables.
"""
distribution = getattr(var.owner, "op", None)
if isinstance(distribution, CategoricalRV):
# TODO: We could compute the initial value of `k`
# if we had a model object.
# k_graph = var.owner.inputs[3].shape[-1]
# (k_graph,), _ = rvs_to_value_vars((k_graph,), apply_transforms=True)
# k = model.fn(k_graph)(initial_point)
try:
k = var.owner.inputs[3].shape[-1].eval()
if k > 2:
return Competence.IDEAL
except MissingInputError:
pass
return Competence.COMPATIBLE
if isinstance(distribution, BernoulliRV):
return Competence.COMPATIBLE
return Competence.INCOMPATIBLE
[docs]
class DEMetropolis(PopulationArrayStepShared):
"""
Differential Evolution Metropolis sampling step.
Parameters
----------
lamb: float
Lambda parameter of the DE proposal mechanism. Defaults to 2.38 / sqrt(2 * ndim)
vars: list
List of variables for sampler
S: standard deviation or covariance matrix
Some measure of variance to parameterize proposal distribution
proposal_dist: function
Function that returns zero-mean deviates when parameterized with
S (and n). Defaults to NormalProposal(S).
scaling: scalar or array
Initial scale factor for epsilon. Defaults to 0.001
tune: str
Which hyperparameter to tune. Defaults to 'scaling', but can also be 'lambda' or None.
tune_interval: int
The frequency of tuning. Defaults to 100 iterations.
model: PyMC Model
Optional model for sampling step. Defaults to None (taken from context).
mode: string or `Mode` instance.
compilation mode passed to PyTensor functions
References
----------
.. [Braak2006] Cajo C.F. ter Braak (2006).
A Markov Chain Monte Carlo version of the genetic algorithm
Differential Evolution: easy Bayesian computing for real parameter spaces.
Statistics and Computing
`link <https://doi.org/10.1007/s11222-006-8769-1>`__
"""
name = "DEMetropolis"
default_blocked = True
stats_dtypes_shapes = {
"accept": (np.float64, []),
"accepted": (bool, []),
"tune": (bool, []),
"scaling": (np.float64, []),
"lambda": (np.float64, []),
}
[docs]
def __init__(
self,
vars=None,
S=None,
proposal_dist=None,
lamb=None,
scaling=0.001,
tune: str | None = "scaling",
tune_interval=100,
model=None,
mode=None,
**kwargs,
):
model = pm.modelcontext(model)
initial_values = model.initial_point()
initial_values_size = sum(initial_values[n.name].size for n in model.value_vars)
if vars is None:
vars = model.continuous_value_vars
else:
vars = get_value_vars_from_user_vars(vars, model)
if S is None:
S = np.ones(initial_values_size)
if proposal_dist is not None:
self.proposal_dist = proposal_dist(S)
else:
self.proposal_dist = NormalProposal(S)
self.scaling = np.atleast_1d(scaling).astype("d")
if lamb is None:
# default to the optimal lambda for normally distributed targets
lamb = 2.38 / np.sqrt(2 * initial_values_size)
self.lamb = float(lamb)
if tune not in {None, "scaling", "lambda"}:
raise ValueError('The parameter "tune" must be one of {None, scaling, lambda}')
self.tune = tune
self.tune_interval = tune_interval
self.steps_until_tune = tune_interval
self.accepted = 0
self.mode = mode
shared = pm.make_shared_replacements(initial_values, vars, model)
self.delta_logp = delta_logp(initial_values, model.logp(), vars, shared)
super().__init__(vars, shared)
[docs]
def astep(self, q0: RaveledVars) -> tuple[RaveledVars, StatsType]:
point_map_info = q0.point_map_info
q0d = q0.data
if not self.steps_until_tune and self.tune:
if self.tune == "scaling":
self.scaling = tune(self.scaling, self.accepted / float(self.tune_interval))
elif self.tune == "lambda":
self.lamb = tune(self.lamb, self.accepted / float(self.tune_interval))
# Reset counter
self.steps_until_tune = self.tune_interval
self.accepted = 0
epsilon = self.proposal_dist() * self.scaling
# differential evolution proposal
# select two other chains
ir1, ir2 = np.random.choice(self.other_chains, 2, replace=False)
r1 = DictToArrayBijection.map(self.population[ir1])
r2 = DictToArrayBijection.map(self.population[ir2])
# propose a jump
q = floatX(q0d + self.lamb * (r1.data - r2.data) + epsilon)
accept = self.delta_logp(q, q0d)
q_new, accepted = metrop_select(accept, q, q0d)
self.accepted += accepted
self.steps_until_tune -= 1
stats = {
"tune": self.tune,
"scaling": self.scaling,
"lambda": self.lamb,
"accept": np.exp(accept),
"accepted": accepted,
}
return RaveledVars(q_new, point_map_info), [stats]
[docs]
@staticmethod
def competence(var, has_grad):
if var.dtype in pm.discrete_types:
return Competence.INCOMPATIBLE
return Competence.COMPATIBLE
[docs]
class DEMetropolisZ(ArrayStepShared):
"""
Adaptive Differential Evolution Metropolis sampling step that uses the past to inform jumps.
Parameters
----------
lamb: float
Lambda parameter of the DE proposal mechanism. Defaults to 2.38 / sqrt(2 * ndim)
vars: list
List of variables for sampler
S: standard deviation or covariance matrix
Some measure of variance to parameterize proposal distribution
proposal_dist: function
Function that returns zero-mean deviates when parameterized with
S (and n). Defaults to NormalProposal(S).
scaling: scalar or array
Initial scale factor for epsilon. Defaults to 0.001
tune: str
Which hyperparameter to tune. Defaults to 'scaling', but can also be 'lambda' or None.
tune_interval: int
The frequency of tuning. Defaults to 100 iterations.
tune_drop_fraction: float
Fraction of tuning steps that will be removed from the samplers history when the tuning ends.
Defaults to 0.9 - keeping the last 10% of tuning steps for good mixing while removing 90% of
potentially unconverged tuning positions.
model: PyMC Model
Optional model for sampling step. Defaults to None (taken from context).
mode: string or `Mode` instance.
compilation mode passed to PyTensor functions
References
----------
.. [Braak2008] Cajo C.F. ter Braak (2008).
Differential Evolution Markov Chain with snooker updater and fewer chains.
Statistics and Computing
`link <https://doi.org/10.1007/s11222-008-9104-9>`__
"""
name = "DEMetropolisZ"
default_blocked = True
stats_dtypes_shapes = {
"accept": (np.float64, []),
"accepted": (bool, []),
"tune": (bool, []),
"scaling": (np.float64, []),
"lambda": (np.float64, []),
}
[docs]
def __init__(
self,
vars=None,
S=None,
proposal_dist=None,
lamb=None,
scaling=0.001,
tune: str | None = "scaling",
tune_interval=100,
tune_drop_fraction: float = 0.9,
model=None,
mode=None,
**kwargs,
):
model = pm.modelcontext(model)
initial_values = model.initial_point()
initial_values_size = sum(initial_values[n.name].size for n in model.value_vars)
if vars is None:
vars = model.continuous_value_vars
else:
vars = get_value_vars_from_user_vars(vars, model)
if S is None:
S = np.ones(initial_values_size)
if proposal_dist is not None:
self.proposal_dist = proposal_dist(S)
else:
self.proposal_dist = NormalProposal(S)
self.scaling = np.atleast_1d(scaling).astype("d")
if lamb is None:
# default to the optimal lambda for normally distributed targets
lamb = 2.38 / np.sqrt(2 * initial_values_size)
self.lamb = float(lamb)
if tune not in {None, "scaling", "lambda"}:
raise ValueError('The parameter "tune" must be one of {None, scaling, lambda}')
self.tune = True
self.tune_target = tune
self.tune_interval = tune_interval
self.tune_drop_fraction = tune_drop_fraction
self.steps_until_tune = tune_interval
self.accepted = 0
# cache local history for the Z-proposals
self._history: list[np.ndarray] = []
# remember initial settings before tuning so they can be reset
self._untuned_settings = dict(
scaling=self.scaling,
lamb=self.lamb,
steps_until_tune=tune_interval,
accepted=self.accepted,
)
self.mode = mode
shared = pm.make_shared_replacements(initial_values, vars, model)
self.delta_logp = delta_logp(initial_values, model.logp(), vars, shared)
super().__init__(vars, shared)
[docs]
def reset_tuning(self):
"""Resets the tuned sampler parameters and history to their initial values."""
# history can't be reset via the _untuned_settings dict because it's a list
self._history = []
for attr, initial_value in self._untuned_settings.items():
setattr(self, attr, initial_value)
return
[docs]
def astep(self, q0: RaveledVars) -> tuple[RaveledVars, StatsType]:
point_map_info = q0.point_map_info
q0d = q0.data
# same tuning scheme as DEMetropolis
if not self.steps_until_tune and self.tune:
if self.tune_target == "scaling":
self.scaling = tune(self.scaling, self.accepted / float(self.tune_interval))
elif self.tune_target == "lambda":
self.lamb = tune(self.lamb, self.accepted / float(self.tune_interval))
# Reset counter
self.steps_until_tune = self.tune_interval
self.accepted = 0
epsilon = self.proposal_dist() * self.scaling
it = len(self._history)
# use the DE-MCMC-Z proposal scheme as soon as the history has 2 entries
if it > 1:
# differential evolution proposal
# select two other chains
iz1 = np.random.randint(it)
iz2 = np.random.randint(it)
while iz2 == iz1:
iz2 = np.random.randint(it)
z1 = self._history[iz1]
z2 = self._history[iz2]
# propose a jump
q = floatX(q0d + self.lamb * (z1 - z2) + epsilon)
else:
# propose just with noise in the first 2 iterations
q = floatX(q0d + epsilon)
accept = self.delta_logp(q, q0d)
q_new, accepted = metrop_select(accept, q, q0d)
self.accepted += accepted
self._history.append(q_new)
self.steps_until_tune -= 1
stats = {
"tune": self.tune,
"scaling": self.scaling,
"lambda": self.lamb,
"accept": np.exp(accept),
"accepted": accepted,
}
return RaveledVars(q_new, point_map_info), [stats]
[docs]
def stop_tuning(self):
"""At the end of the tuning phase, this method removes the first x% of the history
so future proposals are not informed by unconverged tuning iterations.
"""
it = len(self._history)
n_drop = int(self.tune_drop_fraction * it)
self._history = self._history[n_drop:]
return super().stop_tuning()
[docs]
@staticmethod
def competence(var, has_grad):
if var.dtype in pm.discrete_types:
return Competence.INCOMPATIBLE
return Competence.COMPATIBLE
def sample_except(limit, excluded):
candidate = nr.choice(limit - 1)
if candidate >= excluded:
candidate += 1
return candidate
def delta_logp(
point: dict[str, np.ndarray],
logp: pt.TensorVariable,
vars: list[pt.TensorVariable],
shared: dict[pt.TensorVariable, pt.sharedvar.TensorSharedVariable],
) -> pytensor.compile.Function:
[logp0], inarray0 = join_nonshared_inputs(
point=point, outputs=[logp], inputs=vars, shared_inputs=shared
)
tensor_type = inarray0.type
inarray1 = tensor_type("inarray1")
logp1 = CallableTensor(logp0)(inarray1)
# Replace any potential duplicated RNG nodes
(logp1,) = replace_rng_nodes((logp1,))
f = compile_pymc([inarray1, inarray0], logp1 - logp0)
f.trust_input = True
return f